CAS 2410688-61-6 appears in our catalog under these names: ANT3310/ 99.51% (existing batch purity), ANT3310 sodium, ANT3310 (sodium), Pilabactam (sodium), 99.54%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10mM/1mL.
Sodium [(2R,5R)-2-fluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CAS 2410688-61-6) is a chemical compound with the molecular formula C6H8FN2NaO5S and a molecular weight of 262.19 g/mol. IUPAC name: sodium [(2R,5R)-2-fluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate. InChIKey: UIJIKXQAJBMNIR-JBUOLDKXSA-M.
| Molecular formula | C6H8FN2NaO5S |
|---|---|
| Molecular weight | 262.19 g/mol |
| IUPAC name | sodium [(2R,5R)-2-fluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| InChIKey | UIJIKXQAJBMNIR-JBUOLDKXSA-M |
| SMILES | C1C[C@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)[O-])F.[Na+] |
Computed by PubChem (NCBI)