Products 2410700-08-0

CAS 2410700-08-0 is the registry number for 2,4-DIMETHOXY-6-PENTYLBENZALDEHYDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2,4-dimethoxy-6-pentylbenzaldehyde (CAS 2410700-08-0) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: 2,4-dimethoxy-6-pentylbenzaldehyde. InChIKey: LCNXZGMVTPOYQT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O3
Molecular weight236.31 g/mol
IUPAC name2,4-dimethoxy-6-pentylbenzaldehyde
InChIKeyLCNXZGMVTPOYQT-UHFFFAOYSA-N
SMILESCCCCCC1=C(C(=CC(=C1)OC)OC)C=O

Computed by PubChem (NCBI)