CAS 2410985-99-6 is the registry number for Lithium 5-(2,4-difluorophenyl)-1,3,4-thiadiazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium 5-(2,4-difluorophenyl)-1,3,4-thiadiazole-2-carboxylate (CAS 2410985-99-6) is a chemical compound with the molecular formula C9H3F2LiN2O2S and a molecular weight of 248.2 g/mol. IUPAC name: lithium 5-(2,4-difluorophenyl)-1,3,4-thiadiazole-2-carboxylate. InChIKey: OCCGTYDZYFSPCL-UHFFFAOYSA-M.
| Molecular formula | C9H3F2LiN2O2S |
|---|---|
| Molecular weight | 248.2 g/mol |
| IUPAC name | lithium 5-(2,4-difluorophenyl)-1,3,4-thiadiazole-2-carboxylate |
| InChIKey | OCCGTYDZYFSPCL-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC(=C(C=C1F)F)C2=NN=C(S2)C(=O)[O-] |
Computed by PubChem (NCBI)