CAS 2410989-70-5 appears in our catalog under these names: 3–(5–Chlorobiphenyl)–2–phenylpyridine, 3-(5-Chlorobiphenyl)-2-phenylpyridine, 98%, 3-(5-Chloro-(1,1'-biphenyl)-3-yl)-2-phenylpyridine, 98%. Offered by: GLPBio, Fluorochem, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-(3-chloro-5-phenylphenyl)-2-phenylpyridine (CAS 2410989-70-5) is a chemical compound with the molecular formula C23H16ClN and a molecular weight of 341.8 g/mol. IUPAC name: 3-(3-chloro-5-phenylphenyl)-2-phenylpyridine. InChIKey: MDBAQDXTVMKIKO-UHFFFAOYSA-N.
| Molecular formula | C23H16ClN |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | 3-(3-chloro-5-phenylphenyl)-2-phenylpyridine |
| InChIKey | MDBAQDXTVMKIKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Cl)C3=C(N=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)