Products 2411082-25-0
CAS 2411082-25-0 is the registry number for DACN(Ms,Ns). Offered by: MedChemExpress. Available pack sizes: Get quote.
1-methylsulfonyl-5-(2-nitrophenyl)sulfonyl-1,5-diazacyclonon-7-yne (CAS 2411082-25-0) is a chemical compound with the molecular formula C14H17N3O6S2 and a molecular weight of 387.4 g/mol. IUPAC name: 1-methylsulfonyl-5-(2-nitrophenyl)sulfonyl-1,5-diazacyclonon-7-yne. InChIKey: YDKDZBPRKZPTLJ-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O6S2 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 1-methylsulfonyl-5-(2-nitrophenyl)sulfonyl-1,5-diazacyclonon-7-yne |
| InChIKey | YDKDZBPRKZPTLJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCCN(CC#CC1)S(=O)(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)