CAS 2411085-89-5 appears in our catalog under these names: MG–277, MG-277, 98%, MG-277, MG-277, 98.66%, 98.66%, MG-277, 98.68%. Offered by: GLPBio, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 1mg, 5 mg, 1 mg, 25 mg.
CAS 2411085-89-5 identifies a chemical compound with the molecular formula C41H42Cl2FN5O5 and a molecular weight of 774.7 g/mol. InChIKey: BANRYGZZIMCKNA-OYGJEQPESA-N.
| Molecular formula | C41H42Cl2FN5O5 |
|---|---|
| Molecular weight | 774.7 g/mol |
| InChIKey | BANRYGZZIMCKNA-OYGJEQPESA-N |
| SMILES | C1CCC2(CC1)[C@@]3([C@H]([C@@H](N2)C(=O)NCCCCCC4=C5CN(C(=O)C5=CC=C4)C6CCC(=O)NC6=O)C7=C(C(=CC=C7)Cl)F)C8=C(C=C(C=C8)Cl)NC3=O |
Computed by PubChem (NCBI)