Products 2411098-96-7
CAS 2411098-96-7 is the registry number for Thalidomide-O-C5-azide. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg.
4-(5-azidopentoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2411098-96-7) is a chemical compound with the molecular formula C18H19N5O5 and a molecular weight of 385.4 g/mol. IUPAC name: 4-(5-azidopentoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: GQFFVQOOOJFWFV-UHFFFAOYSA-N.
| Molecular formula | C18H19N5O5 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 4-(5-azidopentoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | GQFFVQOOOJFWFV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)