Products 2411099-46-0
CAS 2411099-46-0 is the registry number for TRβ agonist 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[(4-amino-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid (CAS 2411099-46-0) is a chemical compound with the molecular formula C20H25NO3 and a molecular weight of 327.4 g/mol. IUPAC name: 2-[4-[(4-amino-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid. InChIKey: LRRLSPWIANDUIN-UHFFFAOYSA-N.
| Molecular formula | C20H25NO3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 2-[4-[(4-amino-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid |
| InChIKey | LRRLSPWIANDUIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC2=CC(=C(C=C2)N)C(C)C)C)OCC(=O)O |
Computed by PubChem (NCBI)