Products 2411221-72-0

CAS 2411221-72-0 is the registry number for Ethyl 1-(1-hydroxyethyl)cyclobutane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 1-(1-hydroxyethyl)cyclobutane-1-carboxylate (CAS 2411221-72-0) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: ethyl 1-(1-hydroxyethyl)cyclobutane-1-carboxylate. InChIKey: ZPSXUMOBWINYFW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O3
Molecular weight172.22 g/mol
IUPAC nameethyl 1-(1-hydroxyethyl)cyclobutane-1-carboxylate
InChIKeyZPSXUMOBWINYFW-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCC1)C(C)O

Computed by PubChem (NCBI)