Products 2411226-02-1
CAS 2411226-02-1 appears in our catalog under these names: BET bromodomain inhibitor 1, BET bromodomain inhibitor 1, 99.91%, BET bromodomain inhibitor 1, 99.91%, 99.91%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50 mg, 10 mg, 25 mg, 10mM/1mL, 100 mg.
6-[2-(2,4-difluorophenoxy)-5-(ethylsulfonylmethyl)-3-pyridinyl]-8-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one (CAS 2411226-02-1) is a chemical compound with the molecular formula C22H19F2N3O4S and a molecular weight of 459.5 g/mol. IUPAC name: 6-[2-(2,4-difluorophenoxy)-5-(ethylsulfonylmethyl)-3-pyridinyl]-8-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one. InChIKey: UETQFSCWDMJWMM-UHFFFAOYSA-N.
| Molecular formula | C22H19F2N3O4S |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | 6-[2-(2,4-difluorophenoxy)-5-(ethylsulfonylmethyl)-3-pyridinyl]-8-methyl-2H-pyrrolo[1,2-a]pyrazin-1-one |
| InChIKey | UETQFSCWDMJWMM-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)CC1=CC(=C(N=C1)OC2=C(C=C(C=C2)F)F)C3=CC(=C4N3C=CNC4=O)C |
Computed by PubChem (NCBI)
Synonyms:
BET bromodomain inhibitor 1