Products 2411239-01-3

CAS 2411239-01-3 is the registry number for Piperazine-1-carbonyl fluoride hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Piperazine-1-carbonyl fluoride;hydrochloride (CAS 2411239-01-3) is a chemical compound with the molecular formula C5H10ClFN2O and a molecular weight of 168.60 g/mol. IUPAC name: piperazine-1-carbonyl fluoride;hydrochloride. InChIKey: XAYIGCUJRPCTKN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10ClFN2O
Molecular weight168.60 g/mol
IUPAC namepiperazine-1-carbonyl fluoride;hydrochloride
InChIKeyXAYIGCUJRPCTKN-UHFFFAOYSA-N
SMILESC1CN(CCN1)C(=O)F.Cl

Computed by PubChem (NCBI)