CAS 2411289-52-4 appears in our catalog under these names: 1-Cyclobutanecarbonylpiperidin-3-amine dihydrochloride, 95%, (3-Aminopiperidin-1-yl)(cyclobutyl)methanone dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(3-aminopiperidin-1-yl)-cyclobutylmethanone;dihydrochloride (CAS 2411289-52-4) is a chemical compound with the molecular formula C10H20Cl2N2O and a molecular weight of 255.18 g/mol. IUPAC name: (3-aminopiperidin-1-yl)-cyclobutylmethanone;dihydrochloride. InChIKey: NBSFHYMGSPBMJB-UHFFFAOYSA-N.
| Molecular formula | C10H20Cl2N2O |
|---|---|
| Molecular weight | 255.18 g/mol |
| IUPAC name | (3-aminopiperidin-1-yl)-cyclobutylmethanone;dihydrochloride |
| InChIKey | NBSFHYMGSPBMJB-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)N2CCCC(C2)N.Cl.Cl |
Computed by PubChem (NCBI)