Products 241147-91-1
CAS 241147-91-1 is the registry number for 2-(4-Methoxyphenyl)-1,3,2-benzodioxaborole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-(4-methoxyphenyl)-1,3,2-benzodioxaborole (CAS 241147-91-1) is a chemical compound with the molecular formula C13H11BO3 and a molecular weight of 226.04 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1,3,2-benzodioxaborole. InChIKey: FXABINMHGHEYRT-UHFFFAOYSA-N.
| Molecular formula | C13H11BO3 |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1,3,2-benzodioxaborole |
| InChIKey | FXABINMHGHEYRT-UHFFFAOYSA-N |
| SMILES | B1(OC2=CC=CC=C2O1)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)