CAS 2411523-65-2 is the registry number for 1-(Methyl-d3)pyrrolidine-2,5-dione. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(trideuteriomethyl)pyrrolidine-2,5-dione (CAS 2411523-65-2) is a chemical compound with the molecular formula C5H7NO2 and a molecular weight of 116.13 g/mol. IUPAC name: 1-(trideuteriomethyl)pyrrolidine-2,5-dione. InChIKey: KYEACNNYFNZCST-FIBGUPNXSA-N.
| Molecular formula | C5H7NO2 |
|---|---|
| Molecular weight | 116.13 g/mol |
| IUPAC name | 1-(trideuteriomethyl)pyrrolidine-2,5-dione |
| InChIKey | KYEACNNYFNZCST-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)CCC1=O |
Computed by PubChem (NCBI)