CAS 2411590-89-9 appears in our catalog under these names: (1S)-1-(4-Iodophenyl)propan-1-amine hydrochloride, 95%, (S)-1-(4-Iodophenyl)propan-1-amine hydrochloride 95%, (S)-1-(4-Iodophenyl)propan-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
(1S)-1-(4-iodophenyl)propan-1-amine;hydrochloride (CAS 2411590-89-9) is a chemical compound with the molecular formula C9H13ClIN and a molecular weight of 297.56 g/mol. IUPAC name: (1S)-1-(4-iodophenyl)propan-1-amine;hydrochloride. InChIKey: ZLDIRHBNBNZXCK-FVGYRXGTSA-N.
| Molecular formula | C9H13ClIN |
|---|---|
| Molecular weight | 297.56 g/mol |
| IUPAC name | (1S)-1-(4-iodophenyl)propan-1-amine;hydrochloride |
| InChIKey | ZLDIRHBNBNZXCK-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=CC=C(C=C1)I)N.Cl |
Computed by PubChem (NCBI)