CAS 2411590-92-4 appears in our catalog under these names: Teoc-meleu-oh, 95%, Teoc–MeLeu–OH, Teoc-MeLeu-OH, 98%, 98%, Teoc-MeLeu-OH, 99.74%, Teoc-MeLeu-OH, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 250 mg, 1 g.
(2S)-4-methyl-2-[methyl(2-trimethylsilylethoxycarbonyl)amino]pentanoic acid (CAS 2411590-92-4) is a chemical compound with the molecular formula C13H27NO4Si and a molecular weight of 289.44 g/mol. IUPAC name: (2S)-4-methyl-2-[methyl(2-trimethylsilylethoxycarbonyl)amino]pentanoic acid. InChIKey: ISZJODSUCSTOSW-NSHDSACASA-N.
| Molecular formula | C13H27NO4Si |
|---|---|
| Molecular weight | 289.44 g/mol |
| IUPAC name | (2S)-4-methyl-2-[methyl(2-trimethylsilylethoxycarbonyl)amino]pentanoic acid |
| InChIKey | ISZJODSUCSTOSW-NSHDSACASA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)C(=O)OCC[Si](C)(C)C |
Computed by PubChem (NCBI)