Products 2411591-08-5
CAS 2411591-08-5 is the registry number for (1R)-1-(5-bromo-4-methyl-2-pyridyl)ethanol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R)-1-(5-bromo-4-methyl-2-pyridinyl)ethanol (CAS 2411591-08-5) is a chemical compound with the molecular formula C8H10BrNO and a molecular weight of 216.07 g/mol. IUPAC name: (1R)-1-(5-bromo-4-methyl-2-pyridinyl)ethanol. InChIKey: VHFMHCAXAOVJPY-ZCFIWIBFSA-N.
| Molecular formula | C8H10BrNO |
|---|---|
| Molecular weight | 216.07 g/mol |
| IUPAC name | (1R)-1-(5-bromo-4-methyl-2-pyridinyl)ethanol |
| InChIKey | VHFMHCAXAOVJPY-ZCFIWIBFSA-N |
| SMILES | CC1=CC(=NC=C1Br)[C@@H](C)O |
Computed by PubChem (NCBI)