CAS 2411591-10-9 appears in our catalog under these names: (R)-tert-Butyl (1-(2-nitrophenyl)ethyl)carbamate, 95%, (R)–tert–Butyl (1–(2–nitrophenyl)ethyl)carbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
Tert-butyl N-[(1R)-1-(2-nitrophenyl)ethyl]carbamate (CAS 2411591-10-9) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(2-nitrophenyl)ethyl]carbamate. InChIKey: FWSARODNIFWDLV-SECBINFHSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(2-nitrophenyl)ethyl]carbamate |
| InChIKey | FWSARODNIFWDLV-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC=CC=C1[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)