CAS 2411591-84-7 is the registry number for (S)-1-(1-Methyl-1H-pyrazol-4-yl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(1-methylpyrazol-4-yl)ethanamine;hydrochloride (CAS 2411591-84-7) is a chemical compound with the molecular formula C6H12ClN3 and a molecular weight of 161.63 g/mol. IUPAC name: (1S)-1-(1-methylpyrazol-4-yl)ethanamine;hydrochloride. InChIKey: KRCFGJPYGKFYQB-JEDNCBNOSA-N.
| Molecular formula | C6H12ClN3 |
|---|---|
| Molecular weight | 161.63 g/mol |
| IUPAC name | (1S)-1-(1-methylpyrazol-4-yl)ethanamine;hydrochloride |
| InChIKey | KRCFGJPYGKFYQB-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CN(N=C1)C)N.Cl |
Computed by PubChem (NCBI)