Products 241160-20-3
CAS 241160-20-3 is the registry number for Phenylmethyl 4-fluoro-2-(trifluoromethyl)benzoate, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
Benzyl 4-fluoro-2-(trifluoromethyl)benzoate (CAS 241160-20-3) is a chemical compound with the molecular formula C15H10F4O2 and a molecular weight of 298.23 g/mol. IUPAC name: benzyl 4-fluoro-2-(trifluoromethyl)benzoate. InChIKey: WFSKZRLVXDSQQO-UHFFFAOYSA-N.
| Molecular formula | C15H10F4O2 |
|---|---|
| Molecular weight | 298.23 g/mol |
| IUPAC name | benzyl 4-fluoro-2-(trifluoromethyl)benzoate |
| InChIKey | WFSKZRLVXDSQQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)