CAS 2411635-01-1 is the registry number for 6-bromo-4-(bromomethyl)-3-nitroquinoline. Offered by: Chemat. Available pack sizes: 1g.
6-bromo-4-(bromomethyl)-3-nitroquinoline (CAS 2411635-01-1) is a chemical compound with the molecular formula C10H6Br2N2O2 and a molecular weight of 345.97 g/mol. IUPAC name: 6-bromo-4-(bromomethyl)-3-nitroquinoline. InChIKey: QNPWQQKJJUMSQA-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2O2 |
|---|---|
| Molecular weight | 345.97 g/mol |
| IUPAC name | 6-bromo-4-(bromomethyl)-3-nitroquinoline |
| InChIKey | QNPWQQKJJUMSQA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Br)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)