Products 2412-10-4

CAS 2412-10-4 is the registry number for 4,4-Dimethylmorpholin-4-ium iodide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4,4-dimethylmorpholin-4-ium iodide (CAS 2412-10-4) is a chemical compound with the molecular formula C6H14INO and a molecular weight of 243.09 g/mol. IUPAC name: 4,4-dimethylmorpholin-4-ium iodide. InChIKey: YGNXNQMVWHPUET-UHFFFAOYSA-M.

Identity
Molecular formulaC6H14INO
Molecular weight243.09 g/mol
IUPAC name4,4-dimethylmorpholin-4-ium iodide
InChIKeyYGNXNQMVWHPUET-UHFFFAOYSA-M
SMILESC[N+]1(CCOCC1)C.[I-]

Computed by PubChem (NCBI)