Products 2412142-93-7
CAS 2412142-93-7 is the registry number for Antitubercular agent-21. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(Z)-[amino-(4-pyrrolidin-1-yl-2-pyridinyl)methylidene]amino]morpholine-4-carbothioamide (CAS 2412142-93-7) is a chemical compound with the molecular formula C15H22N6OS and a molecular weight of 334.4 g/mol. IUPAC name: N-[(Z)-[amino-(4-pyrrolidin-1-yl-2-pyridinyl)methylidene]amino]morpholine-4-carbothioamide. InChIKey: OOLGZGWLDJHHPK-UHFFFAOYSA-N.
| Molecular formula | C15H22N6OS |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | N-[(Z)-[amino-(4-pyrrolidin-1-yl-2-pyridinyl)methylidene]amino]morpholine-4-carbothioamide |
| InChIKey | OOLGZGWLDJHHPK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC(=NC=C2)/C(=N/NC(=S)N3CCOCC3)/N |
Computed by PubChem (NCBI)
Synonyms:
Antitubercular agent-21