Products 2412761-57-8
CAS 2412761-57-8 is the registry number for TEAD-IN-1, 99.43%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 1 mg.
N-[5-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-6-methoxy-3-pyridinyl]methanesulfonamide (CAS 2412761-57-8) is a chemical compound with the molecular formula C15H20F2N2O3S and a molecular weight of 346.4 g/mol. IUPAC name: N-[5-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-6-methoxy-3-pyridinyl]methanesulfonamide. InChIKey: KJXYCXXAVTYSCU-ONEGZZNKSA-N.
| Molecular formula | C15H20F2N2O3S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | N-[5-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-6-methoxy-3-pyridinyl]methanesulfonamide |
| InChIKey | KJXYCXXAVTYSCU-ONEGZZNKSA-N |
| SMILES | COC1=C(C=C(C=N1)NS(=O)(=O)C)/C=C/C2CCC(CC2)(F)F |
Computed by PubChem (NCBI)