CAS 2412899-25-1 is the registry number for STAT3-IN-50. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3-chloro-5-fluorophenyl)methyl]triazolo[4,5-g]isoquinoline-4,9-dione (CAS 2412899-25-1) is a chemical compound with the molecular formula C16H8ClFN4O2 and a molecular weight of 342.71 g/mol. IUPAC name: 3-[(3-chloro-5-fluorophenyl)methyl]triazolo[4,5-g]isoquinoline-4,9-dione. InChIKey: OJPJJLRVZOPCHM-UHFFFAOYSA-N.
| Molecular formula | C16H8ClFN4O2 |
|---|---|
| Molecular weight | 342.71 g/mol |
| IUPAC name | 3-[(3-chloro-5-fluorophenyl)methyl]triazolo[4,5-g]isoquinoline-4,9-dione |
| InChIKey | OJPJJLRVZOPCHM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=O)C3=C(C2=O)N(N=N3)CC4=CC(=CC(=C4)Cl)F |
Computed by PubChem (NCBI)