CAS 2412987-93-8 is the registry number for N-(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)-N-methylglycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-methylamino]acetic acid (CAS 2412987-93-8) is a chemical compound with the molecular formula C16H15N3O6 and a molecular weight of 345.31 g/mol. IUPAC name: 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-methylamino]acetic acid. InChIKey: IJYBMYZTACXTCW-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O6 |
|---|---|
| Molecular weight | 345.31 g/mol |
| IUPAC name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-methylamino]acetic acid |
| InChIKey | IJYBMYZTACXTCW-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)