CAS 2413212-07-2 appears in our catalog under these names: Afatinib impurity 92, 99.07%, (S)-N4-(4-Fluorophenyl)-7-((tetrahydrofuran-3-yl)oxy)quinazoline-4,6-diamine (Afatinib Impurity), 98%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: 50 mg, 10 mg, 25 mg, 50mg.
4-N-(4-fluorophenyl)-7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine (CAS 2413212-07-2) is a chemical compound with the molecular formula C18H17FN4O2 and a molecular weight of 340.4 g/mol. IUPAC name: 4-N-(4-fluorophenyl)-7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine. InChIKey: DCBBEFYNODKZDK-ZDUSSCGKSA-N.
| Molecular formula | C18H17FN4O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4-N-(4-fluorophenyl)-7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine |
| InChIKey | DCBBEFYNODKZDK-ZDUSSCGKSA-N |
| SMILES | C1COC[C@H]1OC2=C(C=C3C(=C2)N=CN=C3NC4=CC=C(C=C4)F)N |
Computed by PubChem (NCBI)