CAS 2413212-09-4 appears in our catalog under these names: Afatinib Impurity 8, Desfluoro-N-des(4-dimethylamino-2-en-1-oxo)butyl Afatinib. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
4-N-(3-chlorophenyl)-7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine (CAS 2413212-09-4) is a chemical compound with the molecular formula C18H17ClN4O2 and a molecular weight of 356.8 g/mol. IUPAC name: 4-N-(3-chlorophenyl)-7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine. InChIKey: VGCTYFLBQMFZEW-ZDUSSCGKSA-N.
| Molecular formula | C18H17ClN4O2 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 4-N-(3-chlorophenyl)-7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine |
| InChIKey | VGCTYFLBQMFZEW-ZDUSSCGKSA-N |
| SMILES | C1COC[C@H]1OC2=C(C=C3C(=C2)N=CN=C3NC4=CC(=CC=C4)Cl)N |
Computed by PubChem (NCBI)