CAS 2413234-41-8 is the registry number for 2,3,5,6-Tetrafluorophenyl 6-[[(Trifluoromethyl)sulfonyl]oxy]nicotinate, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2,3,5,6-tetrafluorophenyl) 6-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate (CAS 2413234-41-8) is a chemical compound with the molecular formula C13H4F7NO5S and a molecular weight of 419.23 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl) 6-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate. InChIKey: VCMCVXFRAXIJQB-UHFFFAOYSA-N.
| Molecular formula | C13H4F7NO5S |
|---|---|
| Molecular weight | 419.23 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl) 6-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
| InChIKey | VCMCVXFRAXIJQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)OC2=C(C(=CC(=C2F)F)F)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)