Products 2413257-51-7
CAS 2413257-51-7 is the registry number for PI3Kδ-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-methyl-5-[(6-quinolin-3-ylquinazolin-4-yl)amino]phenyl]prop-2-enamide (CAS 2413257-51-7) is a chemical compound with the molecular formula C27H21N5O and a molecular weight of 431.5 g/mol. IUPAC name: N-[2-methyl-5-[(6-quinolin-3-ylquinazolin-4-yl)amino]phenyl]prop-2-enamide. InChIKey: KWOOYTIEVXKZNB-UHFFFAOYSA-N.
| Molecular formula | C27H21N5O |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | N-[2-methyl-5-[(6-quinolin-3-ylquinazolin-4-yl)amino]phenyl]prop-2-enamide |
| InChIKey | KWOOYTIEVXKZNB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC=NC3=C2C=C(C=C3)C4=CC5=CC=CC=C5N=C4)NC(=O)C=C |
Computed by PubChem (NCBI)