CAS 2413441-23-1 appears in our catalog under these names: (5-Chloro-2-(trifluoromethyl)phenyl)(morpholino)methanone, 95%, (5-Chloro-2-(trifluoromethyl)phenyl)(morpholino)methanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
[5-chloro-2-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone (CAS 2413441-23-1) is a chemical compound with the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. IUPAC name: [5-chloro-2-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone. InChIKey: DFJWCXYXAKAQFR-UHFFFAOYSA-N.
| Molecular formula | C12H11ClF3NO2 |
|---|---|
| Molecular weight | 293.67 g/mol |
| IUPAC name | [5-chloro-2-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone |
| InChIKey | DFJWCXYXAKAQFR-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=C(C=CC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)