Products 2413827-87-7
CAS 2413827-87-7 is the registry number for 5'-(3-Formylphenyl)-2',4',6'-trimethyl-[1,1':3',1''-terphenyl]-3,3''-dicarbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3,5-bis(3-formylphenyl)-2,4,6-trimethylphenyl]benzaldehyde (CAS 2413827-87-7) is a chemical compound with the molecular formula C30H24O3 and a molecular weight of 432.5 g/mol. IUPAC name: 3-[3,5-bis(3-formylphenyl)-2,4,6-trimethylphenyl]benzaldehyde. InChIKey: IOVCQRNNYHBZAP-UHFFFAOYSA-N.
| Molecular formula | C30H24O3 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 3-[3,5-bis(3-formylphenyl)-2,4,6-trimethylphenyl]benzaldehyde |
| InChIKey | IOVCQRNNYHBZAP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C2=CC=CC(=C2)C=O)C)C3=CC=CC(=C3)C=O)C)C4=CC=CC(=C4)C=O |
Computed by PubChem (NCBI)