CAS 47732-99-0 appears in our catalog under these names: 1,3,5–Tri(4–acetylphenyl)benzene, 1,1′-[5′-(4-Acetylphenyl)[1,1′:3′,1′′-terphenyl]-4,4′′-diyl]bis[ethanone], 98%, 98%, 1,3,5-Tri(4-acetylphenyl)benzene, 98%, 1,1'-(5'-(4-Acetylphenyl)-[1,1':3',1''-terphenyl]-4,4''-diyl)diethanone, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
1-[4-[3,5-bis(4-acetylphenyl)phenyl]phenyl]ethanone (CAS 47732-99-0) is a chemical compound with the molecular formula C30H24O3 and a molecular weight of 432.5 g/mol. IUPAC name: 1-[4-[3,5-bis(4-acetylphenyl)phenyl]phenyl]ethanone. InChIKey: XSVGLMQQYMQCTR-UHFFFAOYSA-N.
| Molecular formula | C30H24O3 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 1-[4-[3,5-bis(4-acetylphenyl)phenyl]phenyl]ethanone |
| InChIKey | XSVGLMQQYMQCTR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)C(=O)C)C4=CC=C(C=C4)C(=O)C |
Computed by PubChem (NCBI)