CAS 2413848-18-5 is the registry number for tert-Butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate (CAS 2413848-18-5) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate. InChIKey: WINOHIISMKZAHH-SFYZADRCSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (3R,5S)-3-fluoro-5-hydroxypiperidine-1-carboxylate |
| InChIKey | WINOHIISMKZAHH-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H](C1)F)O |
Computed by PubChem (NCBI)