CAS 2413875-21-3 is the registry number for (2-Fluoro-4-(4-fluoro-1H-indole-1-carbonyl)-5-methoxyphenyl)methanol. Offered by: Biosynth. Available pack sizes: 100mg, 50mg.
[5-fluoro-4-(hydroxymethyl)-2-methoxyphenyl]-(4-fluoroindol-1-yl)methanone (CAS 2413875-21-3) is a chemical compound with the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. IUPAC name: [5-fluoro-4-(hydroxymethyl)-2-methoxyphenyl]-(4-fluoroindol-1-yl)methanone. InChIKey: SCOZQJFHIHWXNQ-UHFFFAOYSA-N.
| Molecular formula | C17H13F2NO3 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | [5-fluoro-4-(hydroxymethyl)-2-methoxyphenyl]-(4-fluoroindol-1-yl)methanone |
| InChIKey | SCOZQJFHIHWXNQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)F)C(=O)N2C=CC3=C2C=CC=C3F |
Computed by PubChem (NCBI)