CAS 2413885-67-1 is the registry number for 2-Bromo-2-fluoro-3-phenylbicyclo(1.1.1)pentane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2-bromo-2-fluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2413885-67-1) is a chemical compound with the molecular formula C12H10BrFO2 and a molecular weight of 285.11 g/mol. IUPAC name: 2-bromo-2-fluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: PMWXQFZDWGMSIY-UHFFFAOYSA-N.
| Molecular formula | C12H10BrFO2 |
|---|---|
| Molecular weight | 285.11 g/mol |
| IUPAC name | 2-bromo-2-fluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | PMWXQFZDWGMSIY-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2(F)Br)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)