Products 2413974-52-2
CAS 2413974-52-2 is the registry number for Mt KARI-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-methoxyphenyl)-3-[5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-yl]thiourea (CAS 2413974-52-2) is a chemical compound with the molecular formula C14H11N5O4S2 and a molecular weight of 377.4 g/mol. IUPAC name: 1-(4-methoxyphenyl)-3-[5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-yl]thiourea. InChIKey: YEELHMPVDFYKPL-UHFFFAOYSA-N.
| Molecular formula | C14H11N5O4S2 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-3-[5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-yl]thiourea |
| InChIKey | YEELHMPVDFYKPL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=S)NC2=NN=C(S2)C3=CC=C(O3)[N+](=O)[O-] |
Computed by PubChem (NCBI)