Products 2413974-53-3
CAS 2413974-53-3 is the registry number for Mt KARI-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-fluorophenyl)-3-[5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-yl]thiourea (CAS 2413974-53-3) is a chemical compound with the molecular formula C13H8FN5O3S2 and a molecular weight of 365.4 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-[5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-yl]thiourea. InChIKey: HDQHMZWYSJUDQT-UHFFFAOYSA-N.
| Molecular formula | C13H8FN5O3S2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-[5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-yl]thiourea |
| InChIKey | HDQHMZWYSJUDQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=S)NC2=NN=C(S2)C3=CC=C(O3)[N+](=O)[O-])F |
Computed by PubChem (NCBI)