Products 2413974-69-1
CAS 2413974-69-1 is the registry number for Mt KARI-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-acetyl-N-[5-(5-nitrothiophen-2-yl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide (CAS 2413974-69-1) is a chemical compound with the molecular formula C14H10N4O5S3 and a molecular weight of 410.5 g/mol. IUPAC name: 4-acetyl-N-[5-(5-nitrothiophen-2-yl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide. InChIKey: WFMFLZBQKIAQEH-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O5S3 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 4-acetyl-N-[5-(5-nitrothiophen-2-yl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| InChIKey | WFMFLZBQKIAQEH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)NC2=NN=C(S2)C3=CC=C(S3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Mt KARI-IN-5, orb1687957