CAS 2413983-07-8 is the registry number for (S)-4-Iodo-6a,7,8,9-tetrahydro-6H-pyrido[3,2-b]pyrrolo[1,2-d][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6S)-10-iodo-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (CAS 2413983-07-8) is a chemical compound with the molecular formula C10H11IN2O and a molecular weight of 302.11 g/mol. IUPAC name: (6S)-10-iodo-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene. InChIKey: ACPSZIZMIGZIAG-ZETCQYMHSA-N.
| Molecular formula | C10H11IN2O |
|---|---|
| Molecular weight | 302.11 g/mol |
| IUPAC name | (6S)-10-iodo-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| InChIKey | ACPSZIZMIGZIAG-ZETCQYMHSA-N |
| SMILES | C1C[C@H]2COC3=C(C=CN=C3N2C1)I |
Computed by PubChem (NCBI)