CAS 2413994-65-5 is the registry number for 2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole (CAS 2413994-65-5) is a chemical compound with the molecular formula C14H18BNO2S and a molecular weight of 275.2 g/mol. IUPAC name: 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole. InChIKey: JXIJGHPVSFTLSW-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2S |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
| InChIKey | JXIJGHPVSFTLSW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)SC(=N3)C |
Computed by PubChem (NCBI)