Products 2414049-30-0

CAS 2414049-30-0 is the registry number for Dapoxetine Impurity 26 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-methyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride (CAS 2414049-30-0) is a chemical compound with the molecular formula C20H22ClNO and a molecular weight of 327.8 g/mol. IUPAC name: N-methyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride. InChIKey: USKHWFSVXPFHHA-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22ClNO
Molecular weight327.8 g/mol
IUPAC nameN-methyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride
InChIKeyUSKHWFSVXPFHHA-UHFFFAOYSA-N
SMILESCNC(CCOC1=CC=CC2=CC=CC=C21)C3=CC=CC=C3.Cl

Computed by PubChem (NCBI)