Products 2414195-69-8
CAS 2414195-69-8 is the registry number for BET bromodomain inhibitor 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3,4-dimethoxyphenyl)-N,N-diethyl-4-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]benzenesulfonamide (CAS 2414195-69-8) is a chemical compound with the molecular formula C23H30N2O5S and a molecular weight of 446.6 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-N,N-diethyl-4-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]benzenesulfonamide. InChIKey: CZOWHOAXNNGART-KRWDZBQOSA-N.
| Molecular formula | C23H30N2O5S |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-N,N-diethyl-4-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]benzenesulfonamide |
| InChIKey | CZOWHOAXNNGART-KRWDZBQOSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)[C@H]2CC(=O)N(C2)C)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
BET bromodomain inhibitor 2, orb1687389