CAS 2414484-01-6 is the registry number for IHMT-MST1-39, 99.68%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 10 mg, 10mM/1mL, 50 mg, 5 mg.
4-[[7-(2,6-difluorophenyl)-5,8-dimethyl-6-oxo-7H-pteridin-2-yl]amino]benzenesulfonamide (CAS 2414484-01-6) is a chemical compound with the molecular formula C20H18F2N6O3S and a molecular weight of 460.5 g/mol. IUPAC name: 4-[[7-(2,6-difluorophenyl)-5,8-dimethyl-6-oxo-7H-pteridin-2-yl]amino]benzenesulfonamide. InChIKey: OOEJZUUVEWCSEG-UHFFFAOYSA-N.
| Molecular formula | C20H18F2N6O3S |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | 4-[[7-(2,6-difluorophenyl)-5,8-dimethyl-6-oxo-7H-pteridin-2-yl]amino]benzenesulfonamide |
| InChIKey | OOEJZUUVEWCSEG-UHFFFAOYSA-N |
| SMILES | CN1C(C(=O)N(C2=CN=C(N=C21)NC3=CC=C(C=C3)S(=O)(=O)N)C)C4=C(C=CC=C4F)F |
Computed by PubChem (NCBI)