CAS 2414487-46-8 is the registry number for tert-butyl (3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decane-8-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
Tert-butyl (3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decane-8-carboxylate (CAS 2414487-46-8) is a chemical compound with the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. IUPAC name: tert-butyl (3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: VQMDDDJIPMAUGX-WDEREUQCSA-N.
| Molecular formula | C14H26N2O3 |
|---|---|
| Molecular weight | 270.37 g/mol |
| IUPAC name | tert-butyl (3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | VQMDDDJIPMAUGX-WDEREUQCSA-N |
| SMILES | C[C@H]1[C@H](C2(CCN(CC2)C(=O)OC(C)(C)C)CO1)N |
Computed by PubChem (NCBI)