Products 2414598-74-4
CAS 2414598-74-4 is the registry number for OX11. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-dichloro-N-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]benzenesulfonamide (CAS 2414598-74-4) is a chemical compound with the molecular formula C17H10Cl2N4O3S2 and a molecular weight of 453.3 g/mol. IUPAC name: 3,5-dichloro-N-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]benzenesulfonamide. InChIKey: JLWNZTBWTALPHM-UHFFFAOYSA-N.
| Molecular formula | C17H10Cl2N4O3S2 |
|---|---|
| Molecular weight | 453.3 g/mol |
| IUPAC name | 3,5-dichloro-N-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]benzenesulfonamide |
| InChIKey | JLWNZTBWTALPHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C3=CSC(=N3)NS(=O)(=O)C4=CC(=CC(=C4)Cl)Cl |
Computed by PubChem (NCBI)