Products 2414598-85-7
CAS 2414598-85-7 is the registry number for hCAIX-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophen-3-yl]benzenesulfonamide (CAS 2414598-85-7) is a chemical compound with the molecular formula C18H14N4O3S2 and a molecular weight of 398.5 g/mol. IUPAC name: 4-amino-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophen-3-yl]benzenesulfonamide. InChIKey: BKPTXQBGBXVYFW-UHFFFAOYSA-N.
| Molecular formula | C18H14N4O3S2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 4-amino-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophen-3-yl]benzenesulfonamide |
| InChIKey | BKPTXQBGBXVYFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C3=C(C=CS3)NS(=O)(=O)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)
Synonyms:
hCAIX-IN-12, orb1688142