Products 2414629-94-8
CAS 2414629-94-8 is the registry number for hCAIX/XII-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-7-[[5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]methoxy]chromen-2-one (CAS 2414629-94-8) is a chemical compound with the molecular formula C20H13F3N2O4 and a molecular weight of 402.3 g/mol. IUPAC name: 4-methyl-7-[[5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]methoxy]chromen-2-one. InChIKey: ILDYFPZCGVMURM-UHFFFAOYSA-N.
| Molecular formula | C20H13F3N2O4 |
|---|---|
| Molecular weight | 402.3 g/mol |
| IUPAC name | 4-methyl-7-[[5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]methoxy]chromen-2-one |
| InChIKey | ILDYFPZCGVMURM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC3=NOC(=N3)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
hCAIX/XII-IN-3, orb1688079