Products 2414633-40-0
CAS 2414633-40-0 is the registry number for hCAIX-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[3-methoxy-4-[[1-(3-nitrophenyl)triazol-4-yl]methoxy]phenyl]prop-2-enoic acid (CAS 2414633-40-0) is a chemical compound with the molecular formula C19H16N4O6 and a molecular weight of 396.4 g/mol. IUPAC name: (E)-3-[3-methoxy-4-[[1-(3-nitrophenyl)triazol-4-yl]methoxy]phenyl]prop-2-enoic acid. InChIKey: SRKGDLYYDIWTBU-SOFGYWHQSA-N.
| Molecular formula | C19H16N4O6 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (E)-3-[3-methoxy-4-[[1-(3-nitrophenyl)triazol-4-yl]methoxy]phenyl]prop-2-enoic acid |
| InChIKey | SRKGDLYYDIWTBU-SOFGYWHQSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)O)OCC2=CN(N=N2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
hCAIX-IN-8, orb1688185