CAS 241479-69-6 is the registry number for Efinaconazole Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-1-(2,5-difluorophenyl)-2-(oxan-2-yloxy)propan-1-one (CAS 241479-69-6) is a chemical compound with the molecular formula C14H16F2O3 and a molecular weight of 270.27 g/mol. IUPAC name: (2R)-1-(2,5-difluorophenyl)-2-(oxan-2-yloxy)propan-1-one. InChIKey: PKRHUCFPMFLUSS-CGCSKFHYSA-N.
| Molecular formula | C14H16F2O3 |
|---|---|
| Molecular weight | 270.27 g/mol |
| IUPAC name | (2R)-1-(2,5-difluorophenyl)-2-(oxan-2-yloxy)propan-1-one |
| InChIKey | PKRHUCFPMFLUSS-CGCSKFHYSA-N |
| SMILES | C[C@H](C(=O)C1=C(C=CC(=C1)F)F)OC2CCCCO2 |
Computed by PubChem (NCBI)